Cocamide DEA
Cocamide DEA is a widely used ingredient in cosmetics, personal care, and skincare formulations. Depending on its function, it may serve as a moisturizer, preservative, emulsifier, or active ingredient to enhance the overall effectiveness and performance of a product.
Cocamide DEA, or cocamide diethanolamine, is a diethanolamide made by reacting the mixture of fatty acids from coconut oils with diethanolamine. It is a viscous liquid and is used as a foaming agent in bath products like shampoos and hand soaps, and in cosmetics as an emulsifying agent. See cocamide for the discussion of the lengths of carbon chains in the molecules in the mixture. The chemical formula of individual components is CH3(CH2)nC(=O)N(CH2CH2OH)2, where n typically ranges from 8 to 18.
 Cocoamide diethanolamine
| |
| Identifiers | |
|---|---|
| ChemSpider |
|
| ECHA InfoCard | 100.065.123 |
| EC Number |
|
CompTox Dashboard (EPA)
|
|
| Properties | |
| CH3(CH2)nC(=O)N(CH2CH2OH)2, n ~ 8-18 | |
| Appearance | Yellowish to yellow viscous liquid |
| Hazards | |
| GHS labelling: | |
 
| |
| Danger | |
| H315, H318, H319 | |
| P264, P280, P302+P352, P305+P351+P338, P310, P321, P332+P313, P337+P313, P362 | |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
| |
